C14H19N5O2 — CID 80684480
ethyl 5-amino-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate (PubChem CID 80684480) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 5-amino-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate.
| Compound Name | ethyl 5-amino-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 80684480 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | ethyl 5-amino-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate |
| SMILES | CCOC(=O)c1cc(N)ccc1NCCc1ncn(C)n1 |
| InChI | InChI=1S/C14H19N5O2/c1-3-21-14(20)11-8-10(15)4-5-12(11)16-7-6-13-17-9-19(2)18-13/h4-5,8-9,16H,3,6-7,15H2,1-2H3 |
| InChIKey | HCALDYOUYQKOOG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|