C7H10N6OS — CID 80686363
4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 80686363) has the molecular formula C7H10N6OS and a molecular weight of 226.26 g/mol. Its IUPAC name is 4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 80686363 |
| Molecular Formula | C7H10N6OS |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | Cn1cnc(CCn2c(=O)[nH][nH]c2=S)n1 |
| InChI | InChI=1S/C7H10N6OS/c1-12-4-8-5(11-12)2-3-13-6(14)9-10-7(13)15/h4H,2-3H2,1H3,(H,9,14)(H,10,15) |
| InChIKey | BOCFHVOMWRVXFW-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|