About 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid
4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80687462) has the molecular formula C11H8ClFN2O2S
and a molecular weight of 286.72 g/mol. Its IUPAC name is 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 80687462 |
| Molecular Formula | C11H8ClFN2O2S |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | CN(c1nc(Cl)c(C(=O)O)s1)c1ccccc1F |
| InChI | InChI=1S/C11H8ClFN2O2S/c1-15(7-5-3-2-4-6(7)13)11-14-9(12)8(18-11)10(16)17/h2-5H,1H3,(H,16,17) |
| InChIKey | VPCYMHHNTWDGAK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid (CID 80687462) is 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid is CN(c1nc(Cl)c(C(=O)O)s1)c1ccccc1F.
What is the InChIKey of 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is VPCYMHHNTWDGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O2S/c1-15(7-5-3-2-4-6(7)13)11-14-9(12)8(18-11)10(16)17/h2-5H,1H3,(H,16,17).
What are the key properties of 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid?
4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 286.72 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2-fluoro-N-methylanilino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80687462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).