C12H10BrClN2OS — CID 80688068
2-[(3-bromophenyl)methyl-methylamino]-4-chloro-1,3-thiazole-5-carbaldehyde (PubChem CID 80688068) has the molecular formula C12H10BrClN2OS and a molecular weight of 345.65 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-methylamino]-4-chloro-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[(3-bromophenyl)methyl-methylamino]-4-chloro-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80688068 |
| Molecular Formula | C12H10BrClN2OS |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-methylamino]-4-chloro-1,3-thiazole-5-carbaldehyde |
| SMILES | CN(Cc1cccc(Br)c1)c1nc(Cl)c(C=O)s1 |
| InChI | InChI=1S/C12H10BrClN2OS/c1-16(6-8-3-2-4-9(13)5-8)12-15-11(14)10(7-17)18-12/h2-5,7H,6H2,1H3 |
| InChIKey | AVKXXWKXZLOUPS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|