C13H14FN5 — CID 80688567
4-fluoro-1-[2-(1-methylpyrazol-4-yl)ethyl]benzimidazol-2-amine (PubChem CID 80688567) has the molecular formula C13H14FN5 and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-fluoro-1-[2-(1-methylpyrazol-4-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 4-fluoro-1-[2-(1-methylpyrazol-4-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 80688567 |
| Molecular Formula | C13H14FN5 |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-fluoro-1-[2-(1-methylpyrazol-4-yl)ethyl]benzimidazol-2-amine |
| SMILES | Cn1cc(CCn2c(N)nc3c(F)cccc32)cn1 |
| InChI | InChI=1S/C13H14FN5/c1-18-8-9(7-16-18)5-6-19-11-4-2-3-10(14)12(11)17-13(19)15/h2-4,7-8H,5-6H2,1H3,(H2,15,17) |
| InChIKey | IWXTVNLPBKXHPV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |