C13H23BrN4 — CID 80689947
5-[[2-(3-bromopropyl)pyrrolidin-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole (PubChem CID 80689947) has the molecular formula C13H23BrN4 and a molecular weight of 315.26 g/mol. Its IUPAC name is 5-[[2-(3-bromopropyl)pyrrolidin-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 5-[[2-(3-bromopropyl)pyrrolidin-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 80689947 |
| Molecular Formula | C13H23BrN4 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5-[[2-(3-bromopropyl)pyrrolidin-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1ncnc1CN1CCCC1CCCBr |
| InChI | InChI=1S/C13H23BrN4/c1-11(2)18-13(15-10-16-18)9-17-8-4-6-12(17)5-3-7-14/h10-12H,3-9H2,1-2H3 |
| InChIKey | CQAGVGPMRIRDJD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|