C16H22O2 — CID 80690970
(2-methyloxan-2-yl)-(2,4,5-trimethylphenyl)methanone (PubChem CID 80690970) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2-methyloxan-2-yl)-(2,4,5-trimethylphenyl)methanone.
| Compound Name | (2-methyloxan-2-yl)-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 80690970 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2-methyloxan-2-yl)-(2,4,5-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)C2(C)CCCCO2)cc1C |
| InChI | InChI=1S/C16H22O2/c1-11-9-13(3)14(10-12(11)2)15(17)16(4)7-5-6-8-18-16/h9-10H,5-8H2,1-4H3 |
| InChIKey | NSQWVDDHPJPZEL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |