About 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine
2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine (PubChem CID 80691064) has the molecular formula C9H16BrF2N
and a molecular weight of 256.13 g/mol. Its IUPAC name is 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine.
Molecular Properties
| Compound Name | 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine |
| PubChem CID | 80691064 |
| Molecular Formula | C9H16BrF2N |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine |
| SMILES | FC(F)CN1CCCC1CCCBr |
| InChI | InChI=1S/C9H16BrF2N/c10-5-1-3-8-4-2-6-13(8)7-9(11)12/h8-9H,1-7H2 |
| InChIKey | YGQCDBDFJQWZNJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine?
The IUPAC name of 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine (CID 80691064) is 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine.
What is the SMILES notation for 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine?
The canonical SMILES for 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine is FC(F)CN1CCCC1CCCBr.
What is the InChIKey of 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine?
The InChIKey is YGQCDBDFJQWZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrF2N/c10-5-1-3-8-4-2-6-13(8)7-9(11)12/h8-9H,1-7H2.
What are the key properties of 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine?
2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine has a molecular weight of 256.13 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromopropyl)-1-(2,2-difluoroethyl)pyrrolidine is sourced from PubChem (CID 80691064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).