C13H17Br2NO — CID 80691864
1-[(2-bromo-5-methoxyphenyl)methyl]-3-(bromomethyl)pyrrolidine (PubChem CID 80691864) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxyphenyl)methyl]-3-(bromomethyl)pyrrolidine.
| Compound Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-3-(bromomethyl)pyrrolidine |
|---|---|
| PubChem CID | 80691864 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-3-(bromomethyl)pyrrolidine |
| SMILES | COc1ccc(Br)c(CN2CCC(CBr)C2)c1 |
| InChI | InChI=1S/C13H17Br2NO/c1-17-12-2-3-13(15)11(6-12)9-16-5-4-10(7-14)8-16/h2-3,6,10H,4-5,7-9H2,1H3 |
| InChIKey | MTQRGEISLLREBU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|