C16H23NO2 — CID 80693397
N-(3,3-dimethylcyclopentyl)-2,2-dimethyl-1,3-benzodioxol-5-amine (PubChem CID 80693397) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2,2-dimethyl-1,3-benzodioxol-5-amine.
| Compound Name | N-(3,3-dimethylcyclopentyl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 80693397 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
| SMILES | CC1(C)CCC(Nc2ccc3c(c2)OC(C)(C)O3)C1 |
| InChI | InChI=1S/C16H23NO2/c1-15(2)8-7-12(10-15)17-11-5-6-13-14(9-11)19-16(3,4)18-13/h5-6,9,12,17H,7-8,10H2,1-4H3 |
| InChIKey | RBDSIVZJGKFRGG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|