C11H10ClN3OS2 — CID 80693455
4-chloro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-1,3-thiazole-5-carbaldehyde (PubChem CID 80693455) has the molecular formula C11H10ClN3OS2 and a molecular weight of 299.81 g/mol. Its IUPAC name is 4-chloro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80693455 |
| Molecular Formula | C11H10ClN3OS2 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 4-chloro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(Sc2nc(Cl)c(C=O)s2)nc(C)c1C |
| InChI | InChI=1S/C11H10ClN3OS2/c1-5-6(2)13-10(14-7(5)3)18-11-15-9(12)8(4-16)17-11/h4H,1-3H3 |
| InChIKey | DWSWUOWNKMTHNB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|