About [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol
[4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol (PubChem CID 80693463) has the molecular formula C10H6Cl3NOS2
and a molecular weight of 326.66 g/mol. Its IUPAC name is [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol |
| PubChem CID | 80693463 |
| Molecular Formula | C10H6Cl3NOS2 |
| Molecular Weight | 326.66 g/mol |
| Exact Mass | 324.90 |
| IUPAC Name | [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1sc(Sc2ccc(Cl)c(Cl)c2)nc1Cl |
| InChI | InChI=1S/C10H6Cl3NOS2/c11-6-2-1-5(3-7(6)12)16-10-14-9(13)8(4-15)17-10/h1-3,15H,4H2 |
| InChIKey | BISWMIFLEBKSEJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol?
The IUPAC name of [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol (CID 80693463) is [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol is OCc1sc(Sc2ccc(Cl)c(Cl)c2)nc1Cl.
What is the InChIKey of [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol?
The InChIKey is BISWMIFLEBKSEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl3NOS2/c11-6-2-1-5(3-7(6)12)16-10-14-9(13)8(4-15)17-10/h1-3,15H,4H2.
What are the key properties of [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol?
[4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol has a molecular weight of 326.66 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-2-(3,4-dichlorophenyl)sulfanyl-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 80693463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).