C8H7ClN4O2S2 — CID 80693562
4-chloro-2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 80693562) has the molecular formula C8H7ClN4O2S2 and a molecular weight of 290.76 g/mol. Its IUPAC name is 4-chloro-2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80693562 |
| Molecular Formula | C8H7ClN4O2S2 |
| Molecular Weight | 290.76 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 4-chloro-2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | CCn1c(Sc2nc(Cl)c(C=O)s2)n[nH]c1=O |
| InChI | InChI=1S/C8H7ClN4O2S2/c1-2-13-6(15)11-12-7(13)17-8-10-5(9)4(3-14)16-8/h3H,2H2,1H3,(H,11,15) |
| InChIKey | JAMPEWQRAYAFKB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.76 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|