C11H9ClN2O4S — CID 80693655
[4-chloro-2-(2-methyl-3-nitrophenoxy)-1,3-thiazol-5-yl]methanol (PubChem CID 80693655) has the molecular formula C11H9ClN2O4S and a molecular weight of 300.72 g/mol. Its IUPAC name is [4-chloro-2-(2-methyl-3-nitrophenoxy)-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-chloro-2-(2-methyl-3-nitrophenoxy)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 80693655 |
| Molecular Formula | C11H9ClN2O4S |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | [4-chloro-2-(2-methyl-3-nitrophenoxy)-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1c(Oc2nc(Cl)c(CO)s2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9ClN2O4S/c1-6-7(14(16)17)3-2-4-8(6)18-11-13-10(12)9(5-15)19-11/h2-4,15H,5H2,1H3 |
| InChIKey | NJPHBLPBLKFYAT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|