About 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide
1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide (PubChem CID 80693680) has the molecular formula C9H18FN3O
and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide |
| PubChem CID | 80693680 |
| Molecular Formula | C9H18FN3O |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CNCCN1CCF |
| InChI | InChI=1S/C9H18FN3O/c1-12(2)9(14)8-7-11-4-6-13(8)5-3-10/h8,11H,3-7H2,1-2H3 |
| InChIKey | WIHBGLDVCHAQGZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide?
The IUPAC name of 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide (CID 80693680) is 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide.
What is the SMILES notation for 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide?
The canonical SMILES for 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide is CN(C)C(=O)C1CNCCN1CCF.
What is the InChIKey of 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide?
The InChIKey is WIHBGLDVCHAQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FN3O/c1-12(2)9(14)8-7-11-4-6-13(8)5-3-10/h8,11H,3-7H2,1-2H3.
What are the key properties of 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide?
1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide has a molecular weight of 203.26 g/mol, XLogP of -0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)-N,N-dimethylpiperazine-2-carboxamide is sourced from PubChem (CID 80693680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).