About 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane
6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 80694347) has the molecular formula C10H19FN2
and a molecular weight of 186.27 g/mol. Its IUPAC name is 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane |
| PubChem CID | 80694347 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | FCCN1CCNCC12CCCC2 |
| InChI | InChI=1S/C10H19FN2/c11-5-7-13-8-6-12-9-10(13)3-1-2-4-10/h12H,1-9H2 |
| InChIKey | KICRRYCWTWFPQQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane?
The IUPAC name of 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane (CID 80694347) is 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane is FCCN1CCNCC12CCCC2.
What is the InChIKey of 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane?
The InChIKey is KICRRYCWTWFPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FN2/c11-5-7-13-8-6-12-9-10(13)3-1-2-4-10/h12H,1-9H2.
What are the key properties of 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane?
6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane has a molecular weight of 186.27 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 80694347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).