About 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide
4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide (PubChem CID 80694743) has the molecular formula C7H14FN3O2
and a molecular weight of 191.21 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide.
Molecular Properties
| Compound Name | 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide |
| PubChem CID | 80694743 |
| Molecular Formula | C7H14FN3O2 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(CCF)CCO1 |
| InChI | InChI=1S/C7H14FN3O2/c8-1-2-11-3-4-13-6(5-11)7(9)10-12/h6,12H,1-5H2,(H2,9,10) |
| InChIKey | FQWSSRNMVDFNDP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide?
The IUPAC name of 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide (CID 80694743) is 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide.
What is the SMILES notation for 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide?
The canonical SMILES for 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide is NC(=NO)C1CN(CCF)CCO1.
What is the InChIKey of 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide?
The InChIKey is FQWSSRNMVDFNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FN3O2/c8-1-2-11-3-4-13-6(5-11)7(9)10-12/h6,12H,1-5H2,(H2,9,10).
What are the key properties of 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide?
4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide has a molecular weight of 191.21 g/mol, XLogP of -0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethyl)-N'-hydroxymorpholine-2-carboximidamide is sourced from PubChem (CID 80694743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).