C12H20FNO2 — CID 80694790
1-(2-fluoroethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid (PubChem CID 80694790) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-(2-fluoroethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 80694790 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-(2-fluoroethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)C1CCC2CCCCC2N1CCF |
| InChI | InChI=1S/C12H20FNO2/c13-7-8-14-10-4-2-1-3-9(10)5-6-11(14)12(15)16/h9-11H,1-8H2,(H,15,16) |
| InChIKey | YKVXQKPTZNTBAF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |