About 1-(2-fluoroethyl)-3,5-dimethylpiperazine
1-(2-fluoroethyl)-3,5-dimethylpiperazine (PubChem CID 80694947) has the molecular formula C8H17FN2
and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)-3,5-dimethylpiperazine |
| PubChem CID | 80694947 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 1-(2-fluoroethyl)-3,5-dimethylpiperazine |
| SMILES | CC1CN(CCF)CC(C)N1 |
| InChI | InChI=1S/C8H17FN2/c1-7-5-11(4-3-9)6-8(2)10-7/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | BGXLEUBLSBBMNT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluoroethyl)-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)-3,5-dimethylpiperazine?
The IUPAC name of 1-(2-fluoroethyl)-3,5-dimethylpiperazine (CID 80694947) is 1-(2-fluoroethyl)-3,5-dimethylpiperazine.
What is the SMILES notation for 1-(2-fluoroethyl)-3,5-dimethylpiperazine?
The canonical SMILES for 1-(2-fluoroethyl)-3,5-dimethylpiperazine is CC1CN(CCF)CC(C)N1.
What is the InChIKey of 1-(2-fluoroethyl)-3,5-dimethylpiperazine?
The InChIKey is BGXLEUBLSBBMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FN2/c1-7-5-11(4-3-9)6-8(2)10-7/h7-8,10H,3-6H2,1-2H3.
What are the key properties of 1-(2-fluoroethyl)-3,5-dimethylpiperazine?
1-(2-fluoroethyl)-3,5-dimethylpiperazine has a molecular weight of 160.24 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)-3,5-dimethylpiperazine is sourced from PubChem (CID 80694947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).