C8H6Cl2FN3S — CID 80695029
3,5-dichloro-N-(2-fluoroethyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 80695029) has the molecular formula C8H6Cl2FN3S and a molecular weight of 266.13 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-fluoroethyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(2-fluoroethyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 80695029 |
| Molecular Formula | C8H6Cl2FN3S |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 3,5-dichloro-N-(2-fluoroethyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | FCCNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C8H6Cl2FN3S/c9-4-3-5(10)7-8(14-15-13-7)6(4)12-2-1-11/h3,12H,1-2H2 |
| InChIKey | WSBJCSUDVJDSDF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |