About N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine
N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine (PubChem CID 80695336) has the molecular formula C7H11FN2S
and a molecular weight of 174.24 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine |
| PubChem CID | 80695336 |
| Molecular Formula | C7H11FN2S |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine |
| SMILES | CC(NCCF)c1nccs1 |
| InChI | InChI=1S/C7H11FN2S/c1-6(9-3-2-8)7-10-4-5-11-7/h4-6,9H,2-3H2,1H3 |
| InChIKey | JNPRBPDWPFNNHP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine?
The IUPAC name of N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine (CID 80695336) is N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine.
What is the SMILES notation for N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine?
The canonical SMILES for N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine is CC(NCCF)c1nccs1.
What is the InChIKey of N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine?
The InChIKey is JNPRBPDWPFNNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FN2S/c1-6(9-3-2-8)7-10-4-5-11-7/h4-6,9H,2-3H2,1H3.
What are the key properties of N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine?
N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine has a molecular weight of 174.24 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-1-(1,3-thiazol-2-yl)ethanamine is sourced from PubChem (CID 80695336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).