C11H16FNS — CID 80695811
1-[4-(2-fluoroethylsulfanyl)phenyl]-N-methylethanamine (PubChem CID 80695811) has the molecular formula C11H16FNS and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[4-(2-fluoroethylsulfanyl)phenyl]-N-methylethanamine.
| Compound Name | 1-[4-(2-fluoroethylsulfanyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 80695811 |
| Molecular Formula | C11H16FNS |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-[4-(2-fluoroethylsulfanyl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(SCCF)cc1 |
| InChI | InChI=1S/C11H16FNS/c1-9(13-2)10-3-5-11(6-4-10)14-8-7-12/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | CSWKYTOHPRPMNT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |