About N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine
N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine (PubChem CID 80695847) has the molecular formula C9H18FN
and a molecular weight of 159.25 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine |
| PubChem CID | 80695847 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine |
| SMILES | CC1(C)CCCC1NCCF |
| InChI | InChI=1S/C9H18FN/c1-9(2)5-3-4-8(9)11-7-6-10/h8,11H,3-7H2,1-2H3 |
| InChIKey | FPELPTSKOBVMDJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine?
The IUPAC name of N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine (CID 80695847) is N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine.
What is the SMILES notation for N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine?
The canonical SMILES for N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine is CC1(C)CCCC1NCCF.
What is the InChIKey of N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine?
The InChIKey is FPELPTSKOBVMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FN/c1-9(2)5-3-4-8(9)11-7-6-10/h8,11H,3-7H2,1-2H3.
What are the key properties of N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine?
N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine has a molecular weight of 159.25 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-2,2-dimethylcyclopentan-1-amine is sourced from PubChem (CID 80695847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).