About 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane
15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane (PubChem CID 80696436) has the molecular formula C15H27FN2
and a molecular weight of 254.39 g/mol. Its IUPAC name is 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane.
Molecular Properties
| Compound Name | 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane |
| PubChem CID | 80696436 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane |
| SMILES | FCCN1CC2(CCCCC2)NCC12CCCC2 |
| InChI | InChI=1S/C15H27FN2/c16-10-11-18-13-14(6-2-1-3-7-14)17-12-15(18)8-4-5-9-15/h17H,1-13H2 |
| InChIKey | GOTKTJAOQBBOPU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane?
The IUPAC name of 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane (CID 80696436) is 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane.
What is the SMILES notation for 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane?
The canonical SMILES for 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane is FCCN1CC2(CCCCC2)NCC12CCCC2.
What is the InChIKey of 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane?
The InChIKey is GOTKTJAOQBBOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27FN2/c16-10-11-18-13-14(6-2-1-3-7-14)17-12-15(18)8-4-5-9-15/h17H,1-13H2.
What are the key properties of 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane?
15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane has a molecular weight of 254.39 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 15-(2-fluoroethyl)-7,15-diazadispiro[4.2.58.25]pentadecane is sourced from PubChem (CID 80696436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).