C12H21FN2O2 — CID 80696620
3,6,6-triethyl-1-(2-fluoroethyl)piperazine-2,5-dione (PubChem CID 80696620) has the molecular formula C12H21FN2O2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 3,6,6-triethyl-1-(2-fluoroethyl)piperazine-2,5-dione.
| Compound Name | 3,6,6-triethyl-1-(2-fluoroethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 80696620 |
| Molecular Formula | C12H21FN2O2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3,6,6-triethyl-1-(2-fluoroethyl)piperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)(CC)N(CCF)C1=O |
| InChI | InChI=1S/C12H21FN2O2/c1-4-9-10(16)15(8-7-13)12(5-2,6-3)11(17)14-9/h9H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | MOIGMMSBMDWKRF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |