About 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione
1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione (PubChem CID 80696911) has the molecular formula C8H13FN2O2
and a molecular weight of 188.20 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione |
| PubChem CID | 80696911 |
| Molecular Formula | C8H13FN2O2 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione |
| SMILES | CC1(C)C(=O)NCC(=O)N1CCF |
| InChI | InChI=1S/C8H13FN2O2/c1-8(2)7(13)10-5-6(12)11(8)4-3-9/h3-5H2,1-2H3,(H,10,13) |
| InChIKey | VWEGCRUFFBSWCV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione?
The IUPAC name of 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione (CID 80696911) is 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione.
What is the SMILES notation for 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione?
The canonical SMILES for 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione is CC1(C)C(=O)NCC(=O)N1CCF.
What is the InChIKey of 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione?
The InChIKey is VWEGCRUFFBSWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2O2/c1-8(2)7(13)10-5-6(12)11(8)4-3-9/h3-5H2,1-2H3,(H,10,13).
What are the key properties of 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione?
1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione has a molecular weight of 188.20 g/mol, XLogP of -0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)-6,6-dimethylpiperazine-2,5-dione is sourced from PubChem (CID 80696911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).