C9H15FN2O2 — CID 80697018
1-(2-fluoroethyl)-3,6,6-trimethylpiperazine-2,5-dione (PubChem CID 80697018) has the molecular formula C9H15FN2O2 and a molecular weight of 202.23 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3,6,6-trimethylpiperazine-2,5-dione.
| Compound Name | 1-(2-fluoroethyl)-3,6,6-trimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 80697018 |
| Molecular Formula | C9H15FN2O2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(2-fluoroethyl)-3,6,6-trimethylpiperazine-2,5-dione |
| SMILES | CC1NC(=O)C(C)(C)N(CCF)C1=O |
| InChI | InChI=1S/C9H15FN2O2/c1-6-7(13)12(5-4-10)9(2,3)8(14)11-6/h6H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | WKTNOETVMRAKAT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |