C9H15FN2O2 — CID 80697304
1-(2-fluoroethyl)-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 80697304) has the molecular formula C9H15FN2O2 and a molecular weight of 202.23 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(2-fluoroethyl)-3-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 80697304 |
| Molecular Formula | C9H15FN2O2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(2-fluoroethyl)-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C1NC(=O)CN(CCF)C1=O |
| InChI | InChI=1S/C9H15FN2O2/c1-6(2)8-9(14)12(4-3-10)5-7(13)11-8/h6,8H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | INONVHHWLLUVRR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |