C14H14ClN3O2S — CID 80697349
2-chloro-5-cyano-N-(cyanomethyl)-N-cyclopentylbenzenesulfonamide (PubChem CID 80697349) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-(cyanomethyl)-N-cyclopentylbenzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-(cyanomethyl)-N-cyclopentylbenzenesulfonamide |
|---|---|
| PubChem CID | 80697349 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-chloro-5-cyano-N-(cyanomethyl)-N-cyclopentylbenzenesulfonamide |
| SMILES | N#CCN(C1CCCC1)S(=O)(=O)c1cc(C#N)ccc1Cl |
| InChI | InChI=1S/C14H14ClN3O2S/c15-13-6-5-11(10-17)9-14(13)21(19,20)18(8-7-16)12-3-1-2-4-12/h5-6,9,12H,1-4,8H2 |
| InChIKey | XSYGEBWVPWEAHX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|