About 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane
3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane (PubChem CID 80697587) has the molecular formula C11H21FN2
and a molecular weight of 200.30 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane |
| PubChem CID | 80697587 |
| Molecular Formula | C11H21FN2 |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane |
| SMILES | CC1(C2CC2)CN(CCF)CCCN1 |
| InChI | InChI=1S/C11H21FN2/c1-11(10-3-4-10)9-14(8-5-12)7-2-6-13-11/h10,13H,2-9H2,1H3 |
| InChIKey | TZPSRESHNZQXMM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane?
The IUPAC name of 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane (CID 80697587) is 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane.
What is the SMILES notation for 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane?
The canonical SMILES for 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane is CC1(C2CC2)CN(CCF)CCCN1.
What is the InChIKey of 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane?
The InChIKey is TZPSRESHNZQXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FN2/c1-11(10-3-4-10)9-14(8-5-12)7-2-6-13-11/h10,13H,2-9H2,1H3.
What are the key properties of 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane?
3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane has a molecular weight of 200.30 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-(2-fluoroethyl)-3-methyl-1,4-diazepane is sourced from PubChem (CID 80697587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).