About 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione
10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione (PubChem CID 80698060) has the molecular formula C11H17FN2O2
and a molecular weight of 228.27 g/mol. Its IUPAC name is 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione.
Molecular Properties
| Compound Name | 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione |
| PubChem CID | 80698060 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione |
| SMILES | O=C1CCN(CCF)C(=O)C2(CCCC2)N1 |
| InChI | InChI=1S/C11H17FN2O2/c12-6-8-14-7-3-9(15)13-11(10(14)16)4-1-2-5-11/h1-8H2,(H,13,15) |
| InChIKey | ABYZMMQNJHVVNN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione?
The IUPAC name of 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione (CID 80698060) is 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione.
What is the SMILES notation for 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione?
The canonical SMILES for 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione is O=C1CCN(CCF)C(=O)C2(CCCC2)N1.
What is the InChIKey of 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione?
The InChIKey is ABYZMMQNJHVVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2O2/c12-6-8-14-7-3-9(15)13-11(10(14)16)4-1-2-5-11/h1-8H2,(H,13,15).
What are the key properties of 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione?
10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione has a molecular weight of 228.27 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-fluoroethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione is sourced from PubChem (CID 80698060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).