About 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid
3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid (PubChem CID 80698919) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid.
Analyze 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid?
The IUPAC name of 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid (CID 80698919) is 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid.
What is the SMILES notation for 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid?
The canonical SMILES for 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid is CC(C)N(CCC(=O)O)C1CCC(C)(C)C1.
What is the InChIKey of 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid?
The InChIKey is UTDJEZDNQGANTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-10(2)14(8-6-12(15)16)11-5-7-13(3,4)9-11/h10-11H,5-9H2,1-4H3,(H,15,16).
What are the key properties of 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid?
3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid has a molecular weight of 227.35 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3-dimethylcyclopentyl)-propan-2-ylamino]propanoic acid is sourced from PubChem (CID 80698919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).