About 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol
2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol (PubChem CID 80699612) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol |
| PubChem CID | 80699612 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol |
| SMILES | CCC(N)C1(CCO)CCC(C)(C)C1 |
| InChI | InChI=1S/C12H25NO/c1-4-10(13)12(7-8-14)6-5-11(2,3)9-12/h10,14H,4-9,13H2,1-3H3 |
| InChIKey | OVLCHISPKLKQLD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol?
The IUPAC name of 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol (CID 80699612) is 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol.
What is the SMILES notation for 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol?
The canonical SMILES for 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol is CCC(N)C1(CCO)CCC(C)(C)C1.
What is the InChIKey of 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol?
The InChIKey is OVLCHISPKLKQLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-4-10(13)12(7-8-14)6-5-11(2,3)9-12/h10,14H,4-9,13H2,1-3H3.
What are the key properties of 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol?
2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol has a molecular weight of 199.34 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1-aminopropyl)-3,3-dimethylcyclopentyl]ethanol is sourced from PubChem (CID 80699612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).