C9H15NO3 — CID 80700054
2-[(3,3-dimethylcyclopentylidene)amino]oxyacetic acid (PubChem CID 80700054) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-[(3,3-dimethylcyclopentylidene)amino]oxyacetic acid.
| Compound Name | 2-[(3,3-dimethylcyclopentylidene)amino]oxyacetic acid |
|---|---|
| PubChem CID | 80700054 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-[(3,3-dimethylcyclopentylidene)amino]oxyacetic acid |
| SMILES | CC1(C)CCC(=NOCC(=O)O)C1 |
| InChI | InChI=1S/C9H15NO3/c1-9(2)4-3-7(5-9)10-13-6-8(11)12/h3-6H2,1-2H3,(H,11,12) |
| InChIKey | YRTMWAQAILRFCE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|