About 3-(3,3-dimethylcyclopentylidene)propan-1-amine
3-(3,3-dimethylcyclopentylidene)propan-1-amine (PubChem CID 80700174) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 3-(3,3-dimethylcyclopentylidene)propan-1-amine.
Molecular Properties
| Compound Name | 3-(3,3-dimethylcyclopentylidene)propan-1-amine |
| PubChem CID | 80700174 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 3-(3,3-dimethylcyclopentylidene)propan-1-amine |
| SMILES | CC1(C)CCC(=CCCN)C1 |
| InChI | InChI=1S/C10H19N/c1-10(2)6-5-9(8-10)4-3-7-11/h4H,3,5-8,11H2,1-2H3 |
| InChIKey | UVEPGVVFNIGVLV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethylcyclopentylidene)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylcyclopentylidene)propan-1-amine?
The IUPAC name of 3-(3,3-dimethylcyclopentylidene)propan-1-amine (CID 80700174) is 3-(3,3-dimethylcyclopentylidene)propan-1-amine.
What is the SMILES notation for 3-(3,3-dimethylcyclopentylidene)propan-1-amine?
The canonical SMILES for 3-(3,3-dimethylcyclopentylidene)propan-1-amine is CC1(C)CCC(=CCCN)C1.
What is the InChIKey of 3-(3,3-dimethylcyclopentylidene)propan-1-amine?
The InChIKey is UVEPGVVFNIGVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-10(2)6-5-9(8-10)4-3-7-11/h4H,3,5-8,11H2,1-2H3.
What are the key properties of 3-(3,3-dimethylcyclopentylidene)propan-1-amine?
3-(3,3-dimethylcyclopentylidene)propan-1-amine has a molecular weight of 153.27 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylcyclopentylidene)propan-1-amine is sourced from PubChem (CID 80700174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).