C17H24N2O — CID 80701649
N-(1-benzofuran-3-ylmethyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine (PubChem CID 80701649) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1-benzofuran-3-ylmethyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine.
| Compound Name | N-(1-benzofuran-3-ylmethyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 80701649 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(1-benzofuran-3-ylmethyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1coc2ccccc12)C1CCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-19(15-6-2-3-7-15)11-10-18-12-14-13-20-17-9-5-4-8-16(14)17/h4-5,8-9,13,15,18H,2-3,6-7,10-12H2,1H3 |
| InChIKey | BPCANDQUZULRKM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|