About 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol
1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol (PubChem CID 80701819) has the molecular formula C15H18FN3O2
and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol |
| PubChem CID | 80701819 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(Cc2nnc(-c3ccc(F)cc3)o2)CC1 |
| InChI | InChI=1S/C15H18FN3O2/c1-15(20)6-8-19(9-7-15)10-13-17-18-14(21-13)11-2-4-12(16)5-3-11/h2-5,20H,6-10H2,1H3 |
| InChIKey | UGNVXXABHHMPGO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol?
The IUPAC name of 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol (CID 80701819) is 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol.
What is the SMILES notation for 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol?
The canonical SMILES for 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol is CC1(O)CCN(Cc2nnc(-c3ccc(F)cc3)o2)CC1.
What is the InChIKey of 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol?
The InChIKey is UGNVXXABHHMPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3O2/c1-15(20)6-8-19(9-7-15)10-13-17-18-14(21-13)11-2-4-12(16)5-3-11/h2-5,20H,6-10H2,1H3.
What are the key properties of 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol?
1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol has a molecular weight of 291.33 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylpiperidin-4-ol is sourced from PubChem (CID 80701819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).