C15H17NO3 — CID 80702544
1-(1-benzofuran-3-ylmethyl)piperidine-2-carboxylic acid (PubChem CID 80702544) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(1-benzofuran-3-ylmethyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(1-benzofuran-3-ylmethyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 80702544 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(1-benzofuran-3-ylmethyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1Cc1coc2ccccc12 |
| InChI | InChI=1S/C15H17NO3/c17-15(18)13-6-3-4-8-16(13)9-11-10-19-14-7-2-1-5-12(11)14/h1-2,5,7,10,13H,3-4,6,8-9H2,(H,17,18) |
| InChIKey | HFVLQJNXWSKPOO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |