C18H24N2O — CID 80702786
N-(1-benzofuran-3-ylmethyl)-N-(piperidin-4-ylmethyl)cyclopropanamine (PubChem CID 80702786) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-(1-benzofuran-3-ylmethyl)-N-(piperidin-4-ylmethyl)cyclopropanamine.
| Compound Name | N-(1-benzofuran-3-ylmethyl)-N-(piperidin-4-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 80702786 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(1-benzofuran-3-ylmethyl)-N-(piperidin-4-ylmethyl)cyclopropanamine |
| SMILES | c1ccc2c(CN(CC3CCNCC3)C3CC3)coc2c1 |
| InChI | InChI=1S/C18H24N2O/c1-2-4-18-17(3-1)15(13-21-18)12-20(16-5-6-16)11-14-7-9-19-10-8-14/h1-4,13-14,16,19H,5-12H2 |
| InChIKey | TXCRELQSKHGDHN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |