About 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol
1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol (PubChem CID 80703333) has the molecular formula C16H19ClN2OS
and a molecular weight of 322.86 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol |
| PubChem CID | 80703333 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(Cc2csc(-c3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C16H19ClN2OS/c1-16(20)6-8-19(9-7-16)10-12-11-21-15(18-12)13-4-2-3-5-14(13)17/h2-5,11,20H,6-10H2,1H3 |
| InChIKey | ICSSZLRDUXQMGD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol?
The IUPAC name of 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol (CID 80703333) is 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol.
What is the SMILES notation for 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol?
The canonical SMILES for 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol is CC1(O)CCN(Cc2csc(-c3ccccc3Cl)n2)CC1.
What is the InChIKey of 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol?
The InChIKey is ICSSZLRDUXQMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2OS/c1-16(20)6-8-19(9-7-16)10-12-11-21-15(18-12)13-4-2-3-5-14(13)17/h2-5,11,20H,6-10H2,1H3.
What are the key properties of 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol?
1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol has a molecular weight of 322.86 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-4-methylpiperidin-4-ol is sourced from PubChem (CID 80703333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).