C11H12ClN3O2S — CID 80703952
2-chloro-5-cyano-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 80703952) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 80703952 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-chloro-5-cyano-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)N[C@H]2CCNC2)c1 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-10-2-1-8(6-13)5-11(10)18(16,17)15-9-3-4-14-7-9/h1-2,5,9,14-15H,3-4,7H2/t9-/m0/s1 |
| InChIKey | RSGJTBDSYIMKPN-VIFPVBQESA-N |
| XLogP | 0.85 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |