About N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline
N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline (PubChem CID 80705917) has the molecular formula C19H31N
and a molecular weight of 273.46 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline |
| PubChem CID | 80705917 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline |
| SMILES | CC(C)c1ccc(NC2CCC(C)(C)C2)c(C(C)C)c1 |
| InChI | InChI=1S/C19H31N/c1-13(2)15-7-8-18(17(11-15)14(3)4)20-16-9-10-19(5,6)12-16/h7-8,11,13-14,16,20H,9-10,12H2,1-6H3 |
| InChIKey | QGABUVHKUWMLIR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline?
The IUPAC name of N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline (CID 80705917) is N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline.
What is the SMILES notation for N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline?
The canonical SMILES for N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline is CC(C)c1ccc(NC2CCC(C)(C)C2)c(C(C)C)c1.
What is the InChIKey of N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline?
The InChIKey is QGABUVHKUWMLIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N/c1-13(2)15-7-8-18(17(11-15)14(3)4)20-16-9-10-19(5,6)12-16/h7-8,11,13-14,16,20H,9-10,12H2,1-6H3.
What are the key properties of N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline?
N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline has a molecular weight of 273.46 g/mol, XLogP of 5.92, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylcyclopentyl)-2,4-di(propan-2-yl)aniline is sourced from PubChem (CID 80705917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).