C13H22F3NO3 — CID 80707265
tert-butyl (2S)-3-methyl-2-(4,4,4-trifluorobutanoylamino)butanoate (PubChem CID 80707265) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-(4,4,4-trifluorobutanoylamino)butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-(4,4,4-trifluorobutanoylamino)butanoate |
|---|---|
| PubChem CID | 80707265 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-(4,4,4-trifluorobutanoylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)CCC(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22F3NO3/c1-8(2)10(11(19)20-12(3,4)5)17-9(18)6-7-13(14,15)16/h8,10H,6-7H2,1-5H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | GEYKNIYEGSGTOH-JTQLQIEISA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |