C13H22N2 — CID 80708681
N-[(5-methyl-2-pyridinyl)methyl]hexan-1-amine (PubChem CID 80708681) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[(5-methyl-2-pyridinyl)methyl]hexan-1-amine.
| Compound Name | N-[(5-methyl-2-pyridinyl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 80708681 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[(5-methyl-2-pyridinyl)methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1ccc(C)cn1 |
| InChI | InChI=1S/C13H22N2/c1-3-4-5-6-9-14-11-13-8-7-12(2)10-15-13/h7-8,10,14H,3-6,9,11H2,1-2H3 |
| InChIKey | SSBKMQBFGHAJDK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|