methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate

C10H18FNO2 — CID 80709035

IUPACmethyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate
SMILESCOC(=O)CN(CCF)C1CCCC1
InChIInChI=1S/C10H18FNO2/c1-14-10(13)8-12(7-6-11)9-4-2-3-5-9/h9H,2-8H2,1H3
InChIKeyHRLLVEOQLDZRPE-UHFFFAOYSA-N
MW203.26 g/mol
LogP1.37
Rot. Bonds5

About methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate

methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate (PubChem CID 80709035) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate
PubChem CID80709035
Molecular FormulaC10H18FNO2
Molecular Weight203.26 g/mol
Exact Mass203.13
IUPAC Namemethyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate
SMILESCOC(=O)CN(CCF)C1CCCC1
InChIInChI=1S/C10H18FNO2/c1-14-10(13)8-12(7-6-11)9-4-2-3-5-9/h9H,2-8H2,1H3
InChIKeyHRLLVEOQLDZRPE-UHFFFAOYSA-N
XLogP1.37
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.26
LogP ≤ 51.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate?
The IUPAC name of methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate (CID 80709035) is methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate.
What is the SMILES notation for methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate?
The canonical SMILES for methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate is COC(=O)CN(CCF)C1CCCC1.
What is the InChIKey of methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate?
The InChIKey is HRLLVEOQLDZRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO2/c1-14-10(13)8-12(7-6-11)9-4-2-3-5-9/h9H,2-8H2,1H3.
What are the key properties of methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate?
methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate has a molecular weight of 203.26 g/mol, XLogP of 1.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[cyclopentyl(2-fluoroethyl)amino]acetate is sourced from PubChem (CID 80709035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).