C12H11N5O — CID 80709605
N-(2-methyl-1,2,4-triazol-3-yl)-1H-indole-6-carboxamide (PubChem CID 80709605) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(2-methyl-1,2,4-triazol-3-yl)-1H-indole-6-carboxamide.
| Compound Name | N-(2-methyl-1,2,4-triazol-3-yl)-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 80709605 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(2-methyl-1,2,4-triazol-3-yl)-1H-indole-6-carboxamide |
| SMILES | Cn1ncnc1NC(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C12H11N5O/c1-17-12(14-7-15-17)16-11(18)9-3-2-8-4-5-13-10(8)6-9/h2-7,13H,1H3,(H,14,15,16,18) |
| InChIKey | LNPLBKLBLCSNEL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |