C13H16FNO2 — CID 80710754
2-fluoro-3-methyl-N-[(3-methyloxetan-3-yl)methyl]benzamide (PubChem CID 80710754) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-[(3-methyloxetan-3-yl)methyl]benzamide.
| Compound Name | 2-fluoro-3-methyl-N-[(3-methyloxetan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 80710754 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-fluoro-3-methyl-N-[(3-methyloxetan-3-yl)methyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCC2(C)COC2)c1F |
| InChI | InChI=1S/C13H16FNO2/c1-9-4-3-5-10(11(9)14)12(16)15-6-13(2)7-17-8-13/h3-5H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | MOKITAXMALHHLD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |