About 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine
1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine (PubChem CID 80712502) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 80712502 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine |
| SMILES | Nc1nc2cnccc2n1C1CCOC1 |
| InChI | InChI=1S/C10H12N4O/c11-10-13-8-5-12-3-1-9(8)14(10)7-2-4-15-6-7/h1,3,5,7H,2,4,6H2,(H2,11,13) |
| InChIKey | AWRYLUPKZGADHC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine (CID 80712502) is 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine is Nc1nc2cnccc2n1C1CCOC1.
What is the InChIKey of 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine?
The InChIKey is AWRYLUPKZGADHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c11-10-13-8-5-12-3-1-9(8)14(10)7-2-4-15-6-7/h1,3,5,7H,2,4,6H2,(H2,11,13).
What are the key properties of 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine?
1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine has a molecular weight of 204.23 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)imidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 80712502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).