C9H16N2O — CID 80712785
N-(oxolan-3-yl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 80712785) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-(oxolan-3-yl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(oxolan-3-yl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 80712785 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-(oxolan-3-yl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | C1CCC(NC2CCOC2)=NC1 |
| InChI | InChI=1S/C9H16N2O/c1-2-5-10-9(3-1)11-8-4-6-12-7-8/h8H,1-7H2,(H,10,11) |
| InChIKey | PNTHLQBNNNAWGX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |