About N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide
N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 80713032) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 80713032 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCOC1)c1cscn1 |
| InChI | InChI=1S/C8H10N2O2S/c11-8(7-4-13-5-9-7)10-6-1-2-12-3-6/h4-6H,1-3H2,(H,10,11) |
| InChIKey | OBBORTPRCDDVCG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide (CID 80713032) is N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide is O=C(NC1CCOC1)c1cscn1.
What is the InChIKey of N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is OBBORTPRCDDVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c11-8(7-4-13-5-9-7)10-6-1-2-12-3-6/h4-6H,1-3H2,(H,10,11).
What are the key properties of N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide?
N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 198.25 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-3-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 80713032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).